Products 1808164-35-3
CAS 1808164-35-3 is the registry number for 1-Bromo-3,4-difluoro-2-methoxy-5-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-bromo-3,4-difluoro-2-methoxy-5-nitrobenzene (CAS 1808164-35-3) is a chemical compound with the molecular formula C7H4BrF2NO3 and a molecular weight of 268.01 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2-methoxy-5-nitrobenzene. InChIKey: GDBXGIAMQYRCPI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO3 |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-2-methoxy-5-nitrobenzene |
| InChIKey | GDBXGIAMQYRCPI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)