Products 259243-49-7
CAS 259243-49-7 is the registry number for 1-Bromo-2-(difluoromethoxy)-3-nitro-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-bromo-2-(difluoromethoxy)-3-nitrobenzene (CAS 259243-49-7) is a chemical compound with the molecular formula C7H4BrF2NO3 and a molecular weight of 268.01 g/mol. IUPAC name: 1-bromo-2-(difluoromethoxy)-3-nitrobenzene. InChIKey: IGAOUJCUASPQFS-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO3 |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | 1-bromo-2-(difluoromethoxy)-3-nitrobenzene |
| InChIKey | IGAOUJCUASPQFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OC(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)