CAS 1261569-51-0 is the registry number for Ethyl 3-amino-4-iodobenzoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 3-amino-4-iodobenzoate (CAS 1261569-51-0) is a chemical compound with the molecular formula C9H10INO2 and a molecular weight of 291.09 g/mol. IUPAC name: ethyl 3-amino-4-iodobenzoate. InChIKey: QBJZQAQWVLGNJY-UHFFFAOYSA-N.
| Molecular formula | C9H10INO2 |
|---|---|
| Molecular weight | 291.09 g/mol |
| IUPAC name | ethyl 3-amino-4-iodobenzoate |
| InChIKey | QBJZQAQWVLGNJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)I)N |
Computed by PubChem (NCBI)