CAS 1261571-61-2 is the registry number for 3-Methoxy-4-(trifluoromethoxy)phenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
3-methoxy-4-(trifluoromethoxy)phenol (CAS 1261571-61-2) is a chemical compound with the molecular formula C8H7F3O3 and a molecular weight of 208.13 g/mol. IUPAC name: 3-methoxy-4-(trifluoromethoxy)phenol. InChIKey: WXJSKOYXPZSRQG-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 3-methoxy-4-(trifluoromethoxy)phenol |
| InChIKey | WXJSKOYXPZSRQG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)O)OC(F)(F)F |
Computed by PubChem (NCBI)