CAS 895572-36-8 appears in our catalog under these names: 2–Methoxy–5–(trifluoromethoxy)phenol, 2-Methoxy-5-(trifluoromethoxy)phenol 95+%, 2-Methoxy-5-(trifluoromethoxy)phenol, 95+%, 95+%, 2-Methoxy-5-(trifluoromethoxy)phenol, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
2-methoxy-5-(trifluoromethoxy)phenol (CAS 895572-36-8) is a chemical compound with the molecular formula C8H7F3O3 and a molecular weight of 208.13 g/mol. IUPAC name: 2-methoxy-5-(trifluoromethoxy)phenol. InChIKey: PORCXQLOOCXXPL-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 2-methoxy-5-(trifluoromethoxy)phenol |
| InChIKey | PORCXQLOOCXXPL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)OC(F)(F)F)O |
Computed by PubChem (NCBI)