CAS 23584-87-4 appears in our catalog under these names: 4,5-Dimethyl-2-(trifluoromethyl)furan-3-carboxylic acid, 95%, 4,5-Dimethyl-2-(trifluoromethyl)furan-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4,5-dimethyl-2-(trifluoromethyl)furan-3-carboxylic acid (CAS 23584-87-4) is a chemical compound with the molecular formula C8H7F3O3 and a molecular weight of 208.13 g/mol. IUPAC name: 4,5-dimethyl-2-(trifluoromethyl)furan-3-carboxylic acid. InChIKey: DGGXCYSSPKHSIC-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | 4,5-dimethyl-2-(trifluoromethyl)furan-3-carboxylic acid |
| InChIKey | DGGXCYSSPKHSIC-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=C1C(=O)O)C(F)(F)F)C |
Computed by PubChem (NCBI)