CAS 23584-63-6 is the registry number for Ethyl 2-(trifluoromethyl)furan-3-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl 2-(trifluoromethyl)furan-3-carboxylate (CAS 23584-63-6) is a chemical compound with the molecular formula C8H7F3O3 and a molecular weight of 208.13 g/mol. IUPAC name: ethyl 2-(trifluoromethyl)furan-3-carboxylate. InChIKey: VETYPAIUONGOHC-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O3 |
|---|---|
| Molecular weight | 208.13 g/mol |
| IUPAC name | ethyl 2-(trifluoromethyl)furan-3-carboxylate |
| InChIKey | VETYPAIUONGOHC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC=C1)C(F)(F)F |
Computed by PubChem (NCBI)