CAS 1261590-26-4 is the registry number for 5-(Trifluoromethyl)-2,3-dihydro-1H-isoindol-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(trifluoromethyl)-2,3-dihydroisoindol-1-one (CAS 1261590-26-4) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 5-(trifluoromethyl)-2,3-dihydroisoindol-1-one. InChIKey: LGMSAQINGSZASV-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 5-(trifluoromethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | LGMSAQINGSZASV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C(F)(F)F)C(=O)N1 |
Computed by PubChem (NCBI)