CAS 1261732-45-9 appears in our catalog under these names: 2–Bromo–4–chloro–3–nitropyridine, 2-Bromo-4-chloro-3-nitropyridine 95%, 2-Bromo-4-chloro-3-nitropyridine, 95%, 95%, 2-Bromo-4-chloro-3-nitropyridine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-bromo-4-chloro-3-nitropyridine (CAS 1261732-45-9) is a chemical compound with the molecular formula C5H2BrClN2O2 and a molecular weight of 237.44 g/mol. IUPAC name: 2-bromo-4-chloro-3-nitropyridine. InChIKey: VTXLBYHDDCVJOX-UHFFFAOYSA-N.
| Molecular formula | C5H2BrClN2O2 |
|---|---|
| Molecular weight | 237.44 g/mol |
| IUPAC name | 2-bromo-4-chloro-3-nitropyridine |
| InChIKey | VTXLBYHDDCVJOX-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)