Products 1261740-57-1
CAS 1261740-57-1 is the registry number for 3-Fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid (CAS 1261740-57-1) is a chemical compound with the molecular formula C14H8F4O3 and a molecular weight of 300.20 g/mol. IUPAC name: 3-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: HMPACGRUTXTZNL-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O3 |
|---|---|
| Molecular weight | 300.20 g/mol |
| IUPAC name | 3-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid |
| InChIKey | HMPACGRUTXTZNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)F)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)