Products 1261740-57-1

CAS 1261740-57-1 is the registry number for 3-Fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid (CAS 1261740-57-1) is a chemical compound with the molecular formula C14H8F4O3 and a molecular weight of 300.20 g/mol. IUPAC name: 3-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: HMPACGRUTXTZNL-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8F4O3
Molecular weight300.20 g/mol
IUPAC name3-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid
InChIKeyHMPACGRUTXTZNL-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=CC(=C2)F)C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)