Products 374922-67-5
CAS 374922-67-5 is the registry number for 4-((2,3,5,6-Tetrafluorophenoxy)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid (CAS 374922-67-5) is a chemical compound with the molecular formula C14H8F4O3 and a molecular weight of 300.20 g/mol. IUPAC name: 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid. InChIKey: NQIUCXYOCUKXRR-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O3 |
|---|---|
| Molecular weight | 300.20 g/mol |
| IUPAC name | 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid |
| InChIKey | NQIUCXYOCUKXRR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COC2=C(C(=CC(=C2F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)