Products 926255-81-4

CAS 926255-81-4 is the registry number for 2-Fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid (CAS 926255-81-4) is a chemical compound with the molecular formula C14H8F4O3 and a molecular weight of 300.20 g/mol. IUPAC name: 2-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: YZCWPPJRAAJVSW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8F4O3
Molecular weight300.20 g/mol
IUPAC name2-fluoro-5-[2-(trifluoromethoxy)phenyl]benzoic acid
InChIKeyYZCWPPJRAAJVSW-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC(=C(C=C2)F)C(=O)O)OC(F)(F)F

Computed by PubChem (NCBI)