CAS 926234-72-2 appears in our catalog under these names: 2-Fluoro-4-(2-(trifluoromethoxy)phenyl)benzoic acid, 2-Fluoro-4-[2-(trifluoromethoxy)phenyl]benzoic acid, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 5g, 1g.
2-fluoro-4-[2-(trifluoromethoxy)phenyl]benzoic acid (CAS 926234-72-2) is a chemical compound with the molecular formula C14H8F4O3 and a molecular weight of 300.20 g/mol. IUPAC name: 2-fluoro-4-[2-(trifluoromethoxy)phenyl]benzoic acid. InChIKey: OUQIQTSFCNUHCQ-UHFFFAOYSA-N.
| Molecular formula | C14H8F4O3 |
|---|---|
| Molecular weight | 300.20 g/mol |
| IUPAC name | 2-fluoro-4-[2-(trifluoromethoxy)phenyl]benzoic acid |
| InChIKey | OUQIQTSFCNUHCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=C(C=C2)C(=O)O)F)OC(F)(F)F |
Computed by PubChem (NCBI)