Products 1261892-75-4

CAS 1261892-75-4 is the registry number for 4-(2-Chloro-5-methoxyphenyl)-3-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

4-(2-chloro-5-methoxyphenyl)-3-hydroxybenzoic acid (CAS 1261892-75-4) is a chemical compound with the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. IUPAC name: 4-(2-chloro-5-methoxyphenyl)-3-hydroxybenzoic acid. InChIKey: UYNOKKICCIGOIF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO4
Molecular weight278.69 g/mol
IUPAC name4-(2-chloro-5-methoxyphenyl)-3-hydroxybenzoic acid
InChIKeyUYNOKKICCIGOIF-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)Cl)C2=C(C=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)