Products 3031484-08-6
CAS 3031484-08-6 is the registry number for CaMKIIα-IN-1, 98.53%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 25 mg, 5 mg, 10mM/1mL, 10 mg.
2-[2-(2-chlorophenoxy)-5-hydroxyphenyl]acetic acid (CAS 3031484-08-6) is a chemical compound with the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. IUPAC name: 2-[2-(2-chlorophenoxy)-5-hydroxyphenyl]acetic acid. InChIKey: SUOCIVQMECVECC-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO4 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | 2-[2-(2-chlorophenoxy)-5-hydroxyphenyl]acetic acid |
| InChIKey | SUOCIVQMECVECC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=C(C=C(C=C2)O)CC(=O)O)Cl |
Computed by PubChem (NCBI)