CAS 752231-43-9 is the registry number for Ethyl 2-chloro-5-(5-formyl-2-furyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Ethyl 2-chloro-5-(5-formylfuran-2-yl)benzoate (CAS 752231-43-9) is a chemical compound with the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. IUPAC name: ethyl 2-chloro-5-(5-formylfuran-2-yl)benzoate. InChIKey: KXTGQPLJEJKCDR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO4 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | ethyl 2-chloro-5-(5-formylfuran-2-yl)benzoate |
| InChIKey | KXTGQPLJEJKCDR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C2=CC=C(O2)C=O)Cl |
Computed by PubChem (NCBI)