CAS 333435-04-4 appears in our catalog under these names: 4-(5-Chlorocarbonyl-furan-2-yl)-benzoic acid ethyl ester, 95%, Ethyl 4-(5-(chlorocarbonyl)furan-2-yl)benzoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 50mg.
Ethyl 4-(5-carbonochloridoylfuran-2-yl)benzoate (CAS 333435-04-4) is a chemical compound with the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. IUPAC name: ethyl 4-(5-carbonochloridoylfuran-2-yl)benzoate. InChIKey: OPOPFTSILPZGEL-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO4 |
|---|---|
| Molecular weight | 278.69 g/mol |
| IUPAC name | ethyl 4-(5-carbonochloridoylfuran-2-yl)benzoate |
| InChIKey | OPOPFTSILPZGEL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=CC=C(O2)C(=O)Cl |
Computed by PubChem (NCBI)