CAS 1261895-24-2 is the registry number for 5-(2,4-Dimethoxyphenyl)-2-formylphenol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
4-(2,4-dimethoxyphenyl)-2-hydroxybenzaldehyde (CAS 1261895-24-2) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 4-(2,4-dimethoxyphenyl)-2-hydroxybenzaldehyde. InChIKey: COXDJDBCYFVWFA-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 4-(2,4-dimethoxyphenyl)-2-hydroxybenzaldehyde |
| InChIKey | COXDJDBCYFVWFA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC(=C(C=C2)C=O)O)OC |
Computed by PubChem (NCBI)