Products 1261909-34-5

CAS 1261909-34-5 is the registry number for 2-(5-Formylthiophen-2-yl)-5-methoxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-formylthiophen-2-yl)-5-methoxybenzoic acid (CAS 1261909-34-5) is a chemical compound with the molecular formula C13H10O4S and a molecular weight of 262.28 g/mol. IUPAC name: 2-(5-formylthiophen-2-yl)-5-methoxybenzoic acid. InChIKey: YWYDZMZPMXLXOM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10O4S
Molecular weight262.28 g/mol
IUPAC name2-(5-formylthiophen-2-yl)-5-methoxybenzoic acid
InChIKeyYWYDZMZPMXLXOM-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=CC=C(S2)C=O)C(=O)O

Computed by PubChem (NCBI)