CAS 5361-54-6 appears in our catalog under these names: 4-Benzenesulfonylbenzoic acid, 96%, 4-(Phenylsulfonyl)benzoic acid, 95%, 95%, 4-Benzenesulfonylbenzoic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-(benzenesulfonyl)benzoic acid (CAS 5361-54-6) is a chemical compound with the molecular formula C13H10O4S and a molecular weight of 262.28 g/mol. IUPAC name: 4-(benzenesulfonyl)benzoic acid. InChIKey: PKXDNBNSQBZKFO-UHFFFAOYSA-N.
| Molecular formula | C13H10O4S |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 4-(benzenesulfonyl)benzoic acid |
| InChIKey | PKXDNBNSQBZKFO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)