Products 361472-61-9

CAS 361472-61-9 is the registry number for 4-Formyl-2-methoxyphenyl thiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(4-formyl-2-methoxyphenyl) thiophene-2-carboxylate (CAS 361472-61-9) is a chemical compound with the molecular formula C13H10O4S and a molecular weight of 262.28 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) thiophene-2-carboxylate. InChIKey: ZOLFWKYWRIZFDP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10O4S
Molecular weight262.28 g/mol
IUPAC name(4-formyl-2-methoxyphenyl) thiophene-2-carboxylate
InChIKeyZOLFWKYWRIZFDP-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=CS2

Computed by PubChem (NCBI)