Products 2142003-75-4
CAS 2142003-75-4 appears in our catalog under these names: Antifungal agent 48, Antifungal agent 48, Antifungal agent 48, 99.18%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg, 10 mg.
2,3-dihydroxy-6-methyl-5-(thiophene-2-carbonyl)cyclohepta-2,4,6-trien-1-one (CAS 2142003-75-4) is a chemical compound with the molecular formula C13H10O4S and a molecular weight of 262.28 g/mol. IUPAC name: 2,3-dihydroxy-6-methyl-5-(thiophene-2-carbonyl)cyclohepta-2,4,6-trien-1-one. InChIKey: OJWXHQASZVBEIO-UHFFFAOYSA-N.
| Molecular formula | C13H10O4S |
|---|---|
| Molecular weight | 262.28 g/mol |
| IUPAC name | 2,3-dihydroxy-6-methyl-5-(thiophene-2-carbonyl)cyclohepta-2,4,6-trien-1-one |
| InChIKey | OJWXHQASZVBEIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(C=C1C(=O)C2=CC=CS2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 48, orb2278862