CAS 1261916-91-9 is the registry number for 4-(4-Chlorophenyl)-2-methylphenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4-chlorophenyl)-2-methylphenol (CAS 1261916-91-9) is a chemical compound with the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. IUPAC name: 4-(4-chlorophenyl)-2-methylphenol. InChIKey: QDMDROJKABBRPY-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO |
|---|---|
| Molecular weight | 218.68 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2-methylphenol |
| InChIKey | QDMDROJKABBRPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)