Products 1261932-60-8
CAS 1261932-60-8 appears in our catalog under these names: 5-(4-Methoxy-2-methylphenyl)nicotinic acid, 95%, 5-(4-Methoxy-2-methylphenyl)nicotinic acid, 97%, 5-(4-Methoxy-2-methylphenyl)pyridine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 0,5g, 50mg.
5-(4-methoxy-2-methylphenyl)pyridine-3-carboxylic acid (CAS 1261932-60-8) is a chemical compound with the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. IUPAC name: 5-(4-methoxy-2-methylphenyl)pyridine-3-carboxylic acid. InChIKey: IRXSIXMNWNRLAN-UHFFFAOYSA-N.
| Molecular formula | C14H13NO3 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 5-(4-methoxy-2-methylphenyl)pyridine-3-carboxylic acid |
| InChIKey | IRXSIXMNWNRLAN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)C2=CC(=CN=C2)C(=O)O |
Computed by PubChem (NCBI)