Products 1261953-10-9

CAS 1261953-10-9 is the registry number for 3-(3-Methylphenyl)-5-trifluoromethylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

3-(3-methylphenyl)-5-(trifluoromethyl)benzoic acid (CAS 1261953-10-9) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: 3-(3-methylphenyl)-5-(trifluoromethyl)benzoic acid. InChIKey: NPYYNJUAAYZTHG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11F3O2
Molecular weight280.24 g/mol
IUPAC name3-(3-methylphenyl)-5-(trifluoromethyl)benzoic acid
InChIKeyNPYYNJUAAYZTHG-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2=CC(=CC(=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)