Products 773875-92-6

CAS 773875-92-6 is the registry number for Methyl 4'-(trifluoromethyl)[1,1'-biphenyl]-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 3-[4-(trifluoromethyl)phenyl]benzoate (CAS 773875-92-6) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: methyl 3-[4-(trifluoromethyl)phenyl]benzoate. InChIKey: FROAHOFCAMJFIF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11F3O2
Molecular weight280.24 g/mol
IUPAC namemethyl 3-[4-(trifluoromethyl)phenyl]benzoate
InChIKeyFROAHOFCAMJFIF-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)C(F)(F)F

Computed by PubChem (NCBI)