CAS 127783-73-7 appears in our catalog under these names: Methyl 4'-(trifluoromethyl)[1,1'-biphenyl]-4-carboxylate, 95%, Methyl 4'-(trifluoromethyl)-(1,1'-biphenyl)-4-carboxylate, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 200g.
Methyl 4-[4-(trifluoromethyl)phenyl]benzoate (CAS 127783-73-7) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: methyl 4-[4-(trifluoromethyl)phenyl]benzoate. InChIKey: QMFIMGLTUKGUQO-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O2 |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | methyl 4-[4-(trifluoromethyl)phenyl]benzoate |
| InChIKey | QMFIMGLTUKGUQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)