CAS 91748-18-4 appears in our catalog under these names: Methyl 4'–(trifluoromethyl)–(1,1'–biphenyl)–2–carboxylate, Methyl 4'-(trifluoromethyl)-[1,1'-biphenyl]-2-carboxylate 95+%, 4'-Trifluoromethyl-biphenyl-2-carboxylic acid methyl ester, 95%. Offered by: GLPBio, Ambeed, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2-[4-(trifluoromethyl)phenyl]benzoate (CAS 91748-18-4) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: methyl 2-[4-(trifluoromethyl)phenyl]benzoate. InChIKey: HXCNEYUUOTZZLS-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O2 |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | methyl 2-[4-(trifluoromethyl)phenyl]benzoate |
| InChIKey | HXCNEYUUOTZZLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)