CAS 1261954-11-3 is the registry number for 4'-Cyano-3'-hydroxy-[1,1'-biphenyl]-3,5-dicarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-cyano-3-hydroxyphenyl)benzene-1,3-dicarboxylic acid (CAS 1261954-11-3) is a chemical compound with the molecular formula C15H9NO5 and a molecular weight of 283.23 g/mol. IUPAC name: 5-(4-cyano-3-hydroxyphenyl)benzene-1,3-dicarboxylic acid. InChIKey: SSLXQMGTJVTAHD-UHFFFAOYSA-N.
| Molecular formula | C15H9NO5 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 5-(4-cyano-3-hydroxyphenyl)benzene-1,3-dicarboxylic acid |
| InChIKey | SSLXQMGTJVTAHD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)O)C#N |
Computed by PubChem (NCBI)