Products 36467-52-4

CAS 36467-52-4 is the registry number for 4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(1,3-dioxoisoindol-2-yl)-2-hydroxybenzoic acid (CAS 36467-52-4) is a chemical compound with the molecular formula C15H9NO5 and a molecular weight of 283.23 g/mol. IUPAC name: 4-(1,3-dioxoisoindol-2-yl)-2-hydroxybenzoic acid. InChIKey: JOSOUQLGXHXQDR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9NO5
Molecular weight283.23 g/mol
IUPAC name4-(1,3-dioxoisoindol-2-yl)-2-hydroxybenzoic acid
InChIKeyJOSOUQLGXHXQDR-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC(=C(C=C3)C(=O)O)O

Computed by PubChem (NCBI)