CAS 312746-96-6 appears in our catalog under these names: 2-(2-Hydroxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%, 2-(2-Hydroxyphenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (CAS 312746-96-6) is a chemical compound with the molecular formula C15H9NO5 and a molecular weight of 283.23 g/mol. IUPAC name: 2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: LOCUVUONCCLSGK-UHFFFAOYSA-N.
| Molecular formula | C15H9NO5 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | LOCUVUONCCLSGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)