CAS 15485-80-0 appears in our catalog under these names: 7-Hydroxy-4'-nitroisoflavone, 98%+,RG, 98%+,RG, 7-Hydroxy-4'-nitroisoflavone, 98%+,RG. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
7-hydroxy-3-(4-nitrophenyl)chromen-4-one (CAS 15485-80-0) is a chemical compound with the molecular formula C15H9NO5 and a molecular weight of 283.23 g/mol. IUPAC name: 7-hydroxy-3-(4-nitrophenyl)chromen-4-one. InChIKey: CEESSYSSRMOMDE-UHFFFAOYSA-N.
| Molecular formula | C15H9NO5 |
|---|---|
| Molecular weight | 283.23 g/mol |
| IUPAC name | 7-hydroxy-3-(4-nitrophenyl)chromen-4-one |
| InChIKey | CEESSYSSRMOMDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)