Products 1261960-17-1

CAS 1261960-17-1 is the registry number for 5-(3-Chloro-4-methoxyphenyl)nicotinic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.

Structural formula: {0} (CAS {1})

5-(3-chloro-4-methoxyphenyl)pyridine-3-carboxylic acid (CAS 1261960-17-1) is a chemical compound with the molecular formula C13H10ClNO3 and a molecular weight of 263.67 g/mol. IUPAC name: 5-(3-chloro-4-methoxyphenyl)pyridine-3-carboxylic acid. InChIKey: NFDUXEQQCVSXQT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10ClNO3
Molecular weight263.67 g/mol
IUPAC name5-(3-chloro-4-methoxyphenyl)pyridine-3-carboxylic acid
InChIKeyNFDUXEQQCVSXQT-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C2=CC(=CN=C2)C(=O)O)Cl

Computed by PubChem (NCBI)