Products 1261964-35-5

CAS 1261964-35-5 is the registry number for 5-(4-Carboxy-3-fluorophenyl)-2-cyanophenol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(4-cyano-3-hydroxyphenyl)-2-fluorobenzoic acid (CAS 1261964-35-5) is a chemical compound with the molecular formula C14H8FNO3 and a molecular weight of 257.22 g/mol. IUPAC name: 4-(4-cyano-3-hydroxyphenyl)-2-fluorobenzoic acid. InChIKey: FUQIYGVUFPSIRX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8FNO3
Molecular weight257.22 g/mol
IUPAC name4-(4-cyano-3-hydroxyphenyl)-2-fluorobenzoic acid
InChIKeyFUQIYGVUFPSIRX-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC(=C(C=C2)C(=O)O)F)O)C#N

Computed by PubChem (NCBI)