Products 1797660-05-9
CAS 1797660-05-9 is the registry number for 7-Fluoro-9-oxo-9,10-dihydroacridine-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-fluoro-9-oxo-10H-acridine-2-carboxylic acid (CAS 1797660-05-9) is a chemical compound with the molecular formula C14H8FNO3 and a molecular weight of 257.22 g/mol. IUPAC name: 7-fluoro-9-oxo-10H-acridine-2-carboxylic acid. InChIKey: DOLVQIHRMFIVKS-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO3 |
|---|---|
| Molecular weight | 257.22 g/mol |
| IUPAC name | 7-fluoro-9-oxo-10H-acridine-2-carboxylic acid |
| InChIKey | DOLVQIHRMFIVKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)C3=C(N2)C=CC(=C3)F |
Computed by PubChem (NCBI)