CAS 950271-35-9 appears in our catalog under these names: 3-(4-Fluorophenyl)-2,1-benzoxazole-5-carboxylic acid, 95%, 3-(4-Fluorophenyl)benzo(c)isoxazole-5-carboxylic acid, 95%, 3-(4-Fluorophenyl)-2,1-benzoxazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxylic acid (CAS 950271-35-9) is a chemical compound with the molecular formula C14H8FNO3 and a molecular weight of 257.22 g/mol. IUPAC name: 3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxylic acid. InChIKey: ZALKVWRSKGRCEU-UHFFFAOYSA-N.
| Molecular formula | C14H8FNO3 |
|---|---|
| Molecular weight | 257.22 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-2,1-benzoxazole-5-carboxylic acid |
| InChIKey | ZALKVWRSKGRCEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C=C(C=CC3=NO2)C(=O)O)F |
Computed by PubChem (NCBI)