Products 147809-23-2

CAS 147809-23-2 is the registry number for 2-(4-Fluorophenyl)benzo[d]oxazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-fluorophenyl)-1,3-benzoxazole-5-carboxylic acid (CAS 147809-23-2) is a chemical compound with the molecular formula C14H8FNO3 and a molecular weight of 257.22 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-benzoxazole-5-carboxylic acid. InChIKey: FWFARAZPWHBLKO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8FNO3
Molecular weight257.22 g/mol
IUPAC name2-(4-fluorophenyl)-1,3-benzoxazole-5-carboxylic acid
InChIKeyFWFARAZPWHBLKO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)C(=O)O)F

Computed by PubChem (NCBI)