CAS 1261973-39-0 is the registry number for 2-[Benzo(b)thiophen-2-yl]-3-hydroxypyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-(1-benzothiophen-2-yl)pyridin-3-ol (CAS 1261973-39-0) is a chemical compound with the molecular formula C13H9NOS and a molecular weight of 227.28 g/mol. IUPAC name: 2-(1-benzothiophen-2-yl)pyridin-3-ol. InChIKey: VNDYHYKUILJHAZ-UHFFFAOYSA-N.
| Molecular formula | C13H9NOS |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 2-(1-benzothiophen-2-yl)pyridin-3-ol |
| InChIKey | VNDYHYKUILJHAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2)C3=C(C=CC=N3)O |
Computed by PubChem (NCBI)