CAS 3529-87-1 appears in our catalog under these names: 4-Phenoxyphenyl isothiocyanate, 96%, 4-Phenoxyphenyl isothiocyanate, 4-Phenoxyphenylisothiocyanate 95%, 4-Phenoxyphenyl isothiocyanate, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 0,25g, 2,5g.
1-isothiocyanato-4-phenoxybenzene (CAS 3529-87-1) is a chemical compound with the molecular formula C13H9NOS and a molecular weight of 227.28 g/mol. IUPAC name: 1-isothiocyanato-4-phenoxybenzene. InChIKey: ZKITXAAKDFPASL-UHFFFAOYSA-N.
| Molecular formula | C13H9NOS |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 1-isothiocyanato-4-phenoxybenzene |
| InChIKey | ZKITXAAKDFPASL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)