CAS 3159-07-7 appears in our catalog under these names: Quetiapine EP Impurity G , Quetiapine Impurity G (EP), Dibenzo(b,f)(1,4)thiazepine-11-(10H)one, >95% (HPLC), Dibenzo(b,f)(1,4)thiazepin-11(10H)-one, Dibenzo[b,f][1,4]thiazepin-11(10H)-one, >98.0%(HPLC)(N). Offered by: Chemat Brand, TRC, Mikromol, TCI, Chemat. Available pack sizes: on request, 100mg, 1g, 5g, 25mg, 25g, 10g, 100g.
5H-benzo[b][1,4]benzothiazepin-6-one (CAS 3159-07-7) is a chemical compound with the molecular formula C13H9NOS and a molecular weight of 227.28 g/mol. IUPAC name: 5H-benzo[b][1,4]benzothiazepin-6-one. InChIKey: RTERDTBXBYNZIS-UHFFFAOYSA-N.
| Molecular formula | C13H9NOS |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 5H-benzo[b][1,4]benzothiazepin-6-one |
| InChIKey | RTERDTBXBYNZIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)