CAS 558473-20-4 is the registry number for 2-(Thiophen-2-yl)indolizine-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-thiophen-2-ylindolizine-3-carbaldehyde (CAS 558473-20-4) is a chemical compound with the molecular formula C13H9NOS and a molecular weight of 227.28 g/mol. IUPAC name: 2-thiophen-2-ylindolizine-3-carbaldehyde. InChIKey: PEZDGBKEEBTVES-UHFFFAOYSA-N.
| Molecular formula | C13H9NOS |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 2-thiophen-2-ylindolizine-3-carbaldehyde |
| InChIKey | PEZDGBKEEBTVES-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(N2C=C1)C=O)C3=CC=CS3 |
Computed by PubChem (NCBI)