CAS 1261976-11-7 appears in our catalog under these names: 4–(5–Formylthiophen–2–yl)–2–methylphenol, 4-(5-Formylthiophen-2-yl)-2-methylphenol, 95%, 95%, 4-(5-Formylthiophen-2-yl)-2-methylphenol, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-(4-hydroxy-3-methylphenyl)thiophene-2-carbaldehyde (CAS 1261976-11-7) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: 5-(4-hydroxy-3-methylphenyl)thiophene-2-carbaldehyde. InChIKey: WMFSUIOAALVBME-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | 5-(4-hydroxy-3-methylphenyl)thiophene-2-carbaldehyde |
| InChIKey | WMFSUIOAALVBME-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=C(S2)C=O)O |
Computed by PubChem (NCBI)