CAS 1261977-78-9 is the registry number for 3-(3,5-Dimethylisoxazol-4-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,5-dimethyl-1,2-oxazol-4-yl)phenol (CAS 1261977-78-9) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3-(3,5-dimethyl-1,2-oxazol-4-yl)phenol. InChIKey: XJLRQJVRXSYFPH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)phenol |
| InChIKey | XJLRQJVRXSYFPH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)