CAS 1261978-55-5 is the registry number for 4-(3-Cyanophenyl)-2-fluorophenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(3-fluoro-4-hydroxyphenyl)benzonitrile (CAS 1261978-55-5) is a chemical compound with the molecular formula C13H8FNO and a molecular weight of 213.21 g/mol. IUPAC name: 3-(3-fluoro-4-hydroxyphenyl)benzonitrile. InChIKey: PTNAUPLYUSSPKH-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 3-(3-fluoro-4-hydroxyphenyl)benzonitrile |
| InChIKey | PTNAUPLYUSSPKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=C(C=C2)O)F)C#N |
Computed by PubChem (NCBI)