CAS 1261998-32-6 is the registry number for 4-(5-Cyano-2-fluorophenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-fluoro-3-(4-hydroxyphenyl)benzonitrile (CAS 1261998-32-6) is a chemical compound with the molecular formula C13H8FNO and a molecular weight of 213.21 g/mol. IUPAC name: 4-fluoro-3-(4-hydroxyphenyl)benzonitrile. InChIKey: UDVBQAKNVJDZFN-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 4-fluoro-3-(4-hydroxyphenyl)benzonitrile |
| InChIKey | UDVBQAKNVJDZFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=CC(=C2)C#N)F)O |
Computed by PubChem (NCBI)