Products 330206-45-6

CAS 330206-45-6 is the registry number for 6-Fluoro-2-phenyl-1,3-benzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

6-fluoro-2-phenyl-1,3-benzoxazole (CAS 330206-45-6) is a chemical compound with the molecular formula C13H8FNO and a molecular weight of 213.21 g/mol. IUPAC name: 6-fluoro-2-phenyl-1,3-benzoxazole. InChIKey: XUOIBUTUURVPES-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8FNO
Molecular weight213.21 g/mol
IUPAC name6-fluoro-2-phenyl-1,3-benzoxazole
InChIKeyXUOIBUTUURVPES-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NC3=C(O2)C=C(C=C3)F

Computed by PubChem (NCBI)