CAS 143925-48-8 is the registry number for 5-fluoro-2-phenyl-1,3-benzoxazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
5-fluoro-2-phenyl-1,3-benzoxazole (CAS 143925-48-8) is a chemical compound with the molecular formula C13H8FNO and a molecular weight of 213.21 g/mol. IUPAC name: 5-fluoro-2-phenyl-1,3-benzoxazole. InChIKey: MMXYDZNKSGZJLP-UHFFFAOYSA-N.
| Molecular formula | C13H8FNO |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 5-fluoro-2-phenyl-1,3-benzoxazole |
| InChIKey | MMXYDZNKSGZJLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)F |
Computed by PubChem (NCBI)