Products 1261991-03-0
CAS 1261991-03-0 is the registry number for 3-Fluoro-4-(2-hydroxyphenyl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-fluoro-4-(2-hydroxyphenyl)benzoic acid (CAS 1261991-03-0) is a chemical compound with the molecular formula C13H9FO3 and a molecular weight of 232.21 g/mol. IUPAC name: 3-fluoro-4-(2-hydroxyphenyl)benzoic acid. InChIKey: CEMOOGNGXFJXCR-UHFFFAOYSA-N.
| Molecular formula | C13H9FO3 |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | 3-fluoro-4-(2-hydroxyphenyl)benzoic acid |
| InChIKey | CEMOOGNGXFJXCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=C(C=C2)C(=O)O)F)O |
Computed by PubChem (NCBI)