Products 168100-28-5

CAS 168100-28-5 is the registry number for 4-(4-Carboxy-3-fluorophenyl)phenol, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-fluoro-4-(4-hydroxyphenyl)benzoic acid (CAS 168100-28-5) is a chemical compound with the molecular formula C13H9FO3 and a molecular weight of 232.21 g/mol. IUPAC name: 2-fluoro-4-(4-hydroxyphenyl)benzoic acid. InChIKey: CCSOVFVODXNDGW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9FO3
Molecular weight232.21 g/mol
IUPAC name2-fluoro-4-(4-hydroxyphenyl)benzoic acid
InChIKeyCCSOVFVODXNDGW-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CC(=C(C=C2)C(=O)O)F)O

Computed by PubChem (NCBI)