CAS 22494-43-5 is the registry number for 3'-Fluoro-4-hydroxy-[1,1'-biphenyl]-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(3-fluorophenyl)-2-hydroxybenzoic acid (CAS 22494-43-5) is a chemical compound with the molecular formula C13H9FO3 and a molecular weight of 232.21 g/mol. IUPAC name: 5-(3-fluorophenyl)-2-hydroxybenzoic acid. InChIKey: IGUSMAQARLWHHZ-UHFFFAOYSA-N.
| Molecular formula | C13H9FO3 |
|---|---|
| Molecular weight | 232.21 g/mol |
| IUPAC name | 5-(3-fluorophenyl)-2-hydroxybenzoic acid |
| InChIKey | IGUSMAQARLWHHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)